ChemNet > CAS > 21815-91-8 3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride
21815-91-8 3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride
Ürün Adı |
3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride |
ingilizce adı |
3-Chlorobenzo[b]-2-thiophenecarboxylic acid chloride; 3-Chlorobenzo[b]thiophene-2-carbonyl chloride; AKOS B000002; AKOS AU36-M326; AKOS 92491; 3-CHLOROBENZOTHIOPHENE-2-CARBONYL CHLORIDE; BUTTPARK 30\06-08; ASISCHEM T31091; ART-CHEM-BB B000002; 3-chloro-1-benzothiophene-2-carbonyl chloride |
Moleküler Formülü |
C9H4Cl2OS |
Molekül Ağırlığı |
231.0985 |
InChI |
InChI=1/C9H4Cl2OS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H |
CAS kayıt numarası |
21815-91-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.526g/cm3 |
Ergime noktası |
114℃ |
Kaynama noktası |
342.2°C at 760 mmHg |
Kırılma indisi |
1.686 |
Alevlenme noktası |
160.7°C |
Buhar basıncı |
7.67E-05mmHg at 25°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|